About (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol
(4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol (PubChem CID 104950386) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol |
| PubChem CID | 104950386 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol |
| SMILES | Cc1ccc2c(c1)[C@H](O)CC(C)(CCc1ccccc1)O2 |
| InChI | InChI=1S/C19H22O2/c1-14-8-9-18-16(12-14)17(20)13-19(2,21-18)11-10-15-6-4-3-5-7-15/h3-9,12,17,20H,10-11,13H2,1-2H3/t17-,19?/m1/s1 |
| InChIKey | UVESHCSYSJYLJZ-DUSLRRAJSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol?
The IUPAC name of (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol (CID 104950386) is (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol.
What is the SMILES notation for (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol?
The canonical SMILES for (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol is Cc1ccc2c(c1)[C@H](O)CC(C)(CCc1ccccc1)O2.
What is the InChIKey of (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol?
The InChIKey is UVESHCSYSJYLJZ-DUSLRRAJSA-N. The full InChI is InChI=1S/C19H22O2/c1-14-8-9-18-16(12-14)17(20)13-19(2,21-18)11-10-15-6-4-3-5-7-15/h3-9,12,17,20H,10-11,13H2,1-2H3/t17-,19?/m1/s1.
What are the key properties of (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol?
(4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol has a molecular weight of 282.38 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,6-dimethyl-2-(2-phenylethyl)-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 104950386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).