C14H19BrO2 — CID 114274978
6-bromo-2-butan-2-yl-2-methyl-3,4-dihydrochromen-4-ol (PubChem CID 114274978) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 6-bromo-2-butan-2-yl-2-methyl-3,4-dihydrochromen-4-ol.
| Compound Name | 6-bromo-2-butan-2-yl-2-methyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114274978 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-bromo-2-butan-2-yl-2-methyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC(C)C1(C)CC(O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C14H19BrO2/c1-4-9(2)14(3)8-12(16)11-7-10(15)5-6-13(11)17-14/h5-7,9,12,16H,4,8H2,1-3H3 |
| InChIKey | AOXDACOXURXKSR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |