C17H23BrO2 — CID 114715550
6-bromo-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 114715550) has the molecular formula C17H23BrO2 and a molecular weight of 339.27 g/mol. Its IUPAC name is 6-bromo-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
| Compound Name | 6-bromo-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 114715550 |
| Molecular Formula | C17H23BrO2 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 6-bromo-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | CCCC1CCC2(CC1)CC(O)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H23BrO2/c1-2-3-12-6-8-17(9-7-12)11-15(19)14-10-13(18)4-5-16(14)20-17/h4-5,10,12,15,19H,2-3,6-9,11H2,1H3 |
| InChIKey | DJNDFXKVWZOEMB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |