C15H21FN2O4S — CID 67597790
N'-ethylsulfonyl-N'-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)acetohydrazide (PubChem CID 67597790) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is N'-ethylsulfonyl-N'-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)acetohydrazide.
| Compound Name | N'-ethylsulfonyl-N'-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 67597790 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N'-ethylsulfonyl-N'-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)acetohydrazide |
| SMILES | CCS(=O)(=O)N(NC(C)=O)C1CC(C)(C)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C15H21FN2O4S/c1-5-23(20,21)18(17-10(2)19)13-9-15(3,4)22-14-7-6-11(16)8-12(13)14/h6-8,13H,5,9H2,1-4H3,(H,17,19) |
| InChIKey | WCXOFGZJRYMKMS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|