About N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide
N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide (PubChem CID 21257146) has the molecular formula C16H22N2O3S
and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide.
Molecular Properties
| Compound Name | N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide |
| PubChem CID | 21257146 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide |
| SMILES | CCN(C1CC(C)(C)Oc2ccc(C#N)cc21)S(=O)(=O)CC |
| InChI | InChI=1S/C16H22N2O3S/c1-5-18(22(19,20)6-2)14-10-16(3,4)21-15-8-7-12(11-17)9-13(14)15/h7-9,14H,5-6,10H2,1-4H3 |
| InChIKey | XPZPEJKQOWBJNY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide?
The IUPAC name of N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide (CID 21257146) is N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide.
What is the SMILES notation for N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide?
The canonical SMILES for N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide is CCN(C1CC(C)(C)Oc2ccc(C#N)cc21)S(=O)(=O)CC.
What is the InChIKey of N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide?
The InChIKey is XPZPEJKQOWBJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3S/c1-5-18(22(19,20)6-2)14-10-16(3,4)21-15-8-7-12(11-17)9-13(14)15/h7-9,14H,5-6,10H2,1-4H3.
What are the key properties of N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide?
N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide has a molecular weight of 322.43 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-ethylethanesulfonamide is sourced from PubChem (CID 21257146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).