C20H17N3O8 — CID 139255347
methyl (3S,6S,7aR)-6-(2,4-dinitrophenyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 139255347) has the molecular formula C20H17N3O8 and a molecular weight of 427.37 g/mol. Its IUPAC name is methyl (3S,6S,7aR)-6-(2,4-dinitrophenyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3S,6S,7aR)-6-(2,4-dinitrophenyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 139255347 |
| Molecular Formula | C20H17N3O8 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | methyl (3S,6S,7aR)-6-(2,4-dinitrophenyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C[C@@H]2CO[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C20H17N3O8/c1-30-19(25)20(15-8-7-13(22(26)27)9-16(15)23(28)29)10-14-11-31-17(21(14)18(20)24)12-5-3-2-4-6-12/h2-9,14,17H,10-11H2,1H3/t14-,17+,20+/m1/s1 |
| InChIKey | VTQXTXQFMFTGSG-LIVBEALHSA-N |
| XLogP | 2.24 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|