C19H17N3O3 — CID 50994395
(3S,6R,7aS)-6'-amino-3-phenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-1H-indole]-2',5-dione (PubChem CID 50994395) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3S,6R,7aS)-6'-amino-3-phenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-1H-indole]-2',5-dione.
| Compound Name | (3S,6R,7aS)-6'-amino-3-phenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-1H-indole]-2',5-dione |
|---|---|
| PubChem CID | 50994395 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3S,6R,7aS)-6'-amino-3-phenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-1H-indole]-2',5-dione |
| SMILES | Nc1ccc2c(c1)NC(=O)[C@@]21C[C@H]2CO[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C19H17N3O3/c20-12-6-7-14-15(8-12)21-17(23)19(14)9-13-10-25-16(22(13)18(19)24)11-4-2-1-3-5-11/h1-8,13,16H,9-10,20H2,(H,21,23)/t13-,16-,19+/m0/s1 |
| InChIKey | DQRXGJOPGMZRCF-IYJAJMOOSA-N |
| XLogP | 1.79 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|