C26H24N2O2 — CID 102344400
(3S,6R,7aR)-2',3-diphenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one (PubChem CID 102344400) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3S,6R,7aR)-2',3-diphenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one.
| Compound Name | (3S,6R,7aR)-2',3-diphenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one |
|---|---|
| PubChem CID | 102344400 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (3S,6R,7aR)-2',3-diphenylspiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one |
| SMILES | O=C1N2[C@@H](CO[C@H]2c2ccccc2)C[C@@]12Cc1ccccc1NC2c1ccccc1 |
| InChI | InChI=1S/C26H24N2O2/c29-25-26(16-21-17-30-24(28(21)25)19-11-5-2-6-12-19)15-20-13-7-8-14-22(20)27-23(26)18-9-3-1-4-10-18/h1-14,21,23-24,27H,15-17H2/t21-,23?,24+,26-/m1/s1 |
| InChIKey | CFEPUULRCOTAKZ-BUNUEBROSA-N |
| XLogP | 4.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |