C14H14Cl3NO3 — CID 11046357
(3R,6R,7aS)-3-phenyl-6-(2,2,2-trichloro-1-hydroxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11046357) has the molecular formula C14H14Cl3NO3 and a molecular weight of 350.63 g/mol. Its IUPAC name is (3R,6R,7aS)-3-phenyl-6-(2,2,2-trichloro-1-hydroxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6R,7aS)-3-phenyl-6-(2,2,2-trichloro-1-hydroxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11046357 |
| Molecular Formula | C14H14Cl3NO3 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | (3R,6R,7aS)-3-phenyl-6-(2,2,2-trichloro-1-hydroxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | O=C1[C@@H](C(O)C(Cl)(Cl)Cl)C[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C14H14Cl3NO3/c15-14(16,17)11(19)10-6-9-7-21-13(18(9)12(10)20)8-4-2-1-3-5-8/h1-5,9-11,13,19H,6-7H2/t9-,10+,11?,13+/m0/s1 |
| InChIKey | CXGRGZZXHMKTRV-NMYCGZNZSA-N |
| XLogP | 2.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|