C31H32N2O4 — CID 10951143
tert-butyl 2-[(3R,6S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]-2-(benzhydrylideneamino)acetate (PubChem CID 10951143) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is tert-butyl 2-[(3R,6S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]-2-(benzhydrylideneamino)acetate.
| Compound Name | tert-butyl 2-[(3R,6S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]-2-(benzhydrylideneamino)acetate |
|---|---|
| PubChem CID | 10951143 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | tert-butyl 2-[(3R,6S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]-2-(benzhydrylideneamino)acetate |
| SMILES | CC(C)(C)OC(=O)C(N=C(c1ccccc1)c1ccccc1)[C@@H]1C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C31H32N2O4/c1-31(2,3)37-30(35)27(32-26(21-13-7-4-8-14-21)22-15-9-5-10-16-22)25-19-24-20-36-29(33(24)28(25)34)23-17-11-6-12-18-23/h4-18,24-25,27,29H,19-20H2,1-3H3/t24-,25-,27?,29+/m0/s1 |
| InChIKey | TYSZTGGDGCZAQB-OGXCMGNXSA-N |
| XLogP | 5.18 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|