C26H30N2O5 — CID 170701847
tert-butyl (3S)-3-[(2S)-2-(benzhydrylideneamino)-3-methoxy-3-oxopropyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 170701847) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2S)-2-(benzhydrylideneamino)-3-methoxy-3-oxopropyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2S)-2-(benzhydrylideneamino)-3-methoxy-3-oxopropyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170701847 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | tert-butyl (3S)-3-[(2S)-2-(benzhydrylideneamino)-3-methoxy-3-oxopropyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@H](C[C@@H]1CCN(C(=O)OC(C)(C)C)C1=O)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O5/c1-26(2,3)33-25(31)28-16-15-20(23(28)29)17-21(24(30)32-4)27-22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21H,15-17H2,1-4H3/t20-,21-/m0/s1 |
| InChIKey | DSPYCRXMAUTVLO-SFTDATJTSA-N |
| XLogP | 4.24 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|