C19H17NO4S — CID 7392520
(6R)-2-[hydroxy(phenyl)methylidene]-6-(2-nitrophenyl)sulfanylcyclohexan-1-one (PubChem CID 7392520) has the molecular formula C19H17NO4S and a molecular weight of 355.41 g/mol. Its IUPAC name is (6R)-2-[hydroxy(phenyl)methylidene]-6-(2-nitrophenyl)sulfanylcyclohexan-1-one.
| Compound Name | (6R)-2-[hydroxy(phenyl)methylidene]-6-(2-nitrophenyl)sulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 7392520 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (6R)-2-[hydroxy(phenyl)methylidene]-6-(2-nitrophenyl)sulfanylcyclohexan-1-one |
| SMILES | O=C1C(=C(O)c2ccccc2)CCC[C@H]1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17NO4S/c21-18(13-7-2-1-3-8-13)14-9-6-12-17(19(14)22)25-16-11-5-4-10-15(16)20(23)24/h1-5,7-8,10-11,17,21H,6,9,12H2/t17-/m1/s1 |
| InChIKey | CXDAPAQCVRAWMJ-QGZVFWFLSA-N |
| XLogP | 4.78 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|