C10H11N3O4 — CID 82476606
3,3-dimethyl-5,7-dinitro-1,2-dihydroindole (PubChem CID 82476606) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 3,3-dimethyl-5,7-dinitro-1,2-dihydroindole.
| Compound Name | 3,3-dimethyl-5,7-dinitro-1,2-dihydroindole |
|---|---|
| PubChem CID | 82476606 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3,3-dimethyl-5,7-dinitro-1,2-dihydroindole |
| SMILES | CC1(C)CNc2c([N+](=O)[O-])cc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H11N3O4/c1-10(2)5-11-9-7(10)3-6(12(14)15)4-8(9)13(16)17/h3-4,11H,5H2,1-2H3 |
| InChIKey | IMABIFYKDIKCGH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|