C23H12N4O6 — CID 139216877
6,8-dinitro-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 139216877) has the molecular formula C23H12N4O6 and a molecular weight of 440.37 g/mol. Its IUPAC name is 6,8-dinitro-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | 6,8-dinitro-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 139216877 |
| Molecular Formula | C23H12N4O6 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 6,8-dinitro-2,4-diphenylpyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | O=C1c2c(-c3ccccc3)nc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3c2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H12N4O6/c28-22-18-16-11-15(26(30)31)12-17(27(32)33)21(16)24-20(13-7-3-1-4-8-13)19(18)23(29)25(22)14-9-5-2-6-10-14/h1-12H |
| InChIKey | GDZBOQGWQYHKBF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|