C14H8N4O5 — CID 24796801
5,7-dinitro-3-phenyl-1H-quinoxalin-2-one (PubChem CID 24796801) has the molecular formula C14H8N4O5 and a molecular weight of 312.24 g/mol. Its IUPAC name is 5,7-dinitro-3-phenyl-1H-quinoxalin-2-one.
| Compound Name | 5,7-dinitro-3-phenyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 24796801 |
| Molecular Formula | C14H8N4O5 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5,7-dinitro-3-phenyl-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2nc1-c1ccccc1 |
| InChI | InChI=1S/C14H8N4O5/c19-14-12(8-4-2-1-3-5-8)16-13-10(15-14)6-9(17(20)21)7-11(13)18(22)23/h1-7H,(H,15,19) |
| InChIKey | JQQNZQOEUJDVQO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|