C19H16N4O4 — CID 22895095
2-(4-methyl-2,6-dinitrophenyl)-1,1-diphenylhydrazine (PubChem CID 22895095) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-(4-methyl-2,6-dinitrophenyl)-1,1-diphenylhydrazine.
| Compound Name | 2-(4-methyl-2,6-dinitrophenyl)-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 22895095 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(4-methyl-2,6-dinitrophenyl)-1,1-diphenylhydrazine |
| SMILES | Cc1cc([N+](=O)[O-])c(NN(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N4O4/c1-14-12-17(22(24)25)19(18(13-14)23(26)27)20-21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,20H,1H3 |
| InChIKey | UMXZTBBPWJYGMN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|