C15H12N3O6- — CID 7085200
(2S)-2-(4-methyl-2,6-dinitroanilino)-2-phenylacetate (PubChem CID 7085200) has the molecular formula C15H12N3O6- and a molecular weight of 330.28 g/mol. Its IUPAC name is (2S)-2-(4-methyl-2,6-dinitroanilino)-2-phenylacetate.
| Compound Name | (2S)-2-(4-methyl-2,6-dinitroanilino)-2-phenylacetate |
|---|---|
| PubChem CID | 7085200 |
| Molecular Formula | C15H12N3O6- |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (2S)-2-(4-methyl-2,6-dinitroanilino)-2-phenylacetate |
| SMILES | Cc1cc([N+](=O)[O-])c(N[C@H](C(=O)[O-])c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N3O6/c1-9-7-11(17(21)22)14(12(8-9)18(23)24)16-13(15(19)20)10-5-3-2-4-6-10/h2-8,13,16H,1H3,(H,19,20)/p-1/t13-/m0/s1 |
| InChIKey | SNMOAVZSSXUKTI-ZDUSSCGKSA-M |
| XLogP | 1.71 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|