C11H14N4O4S — CID 154294390
(2R)-N-methyl-2-(4-methyl-2,6-dinitroanilino)propanethioamide (PubChem CID 154294390) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is (2R)-N-methyl-2-(4-methyl-2,6-dinitroanilino)propanethioamide.
| Compound Name | (2R)-N-methyl-2-(4-methyl-2,6-dinitroanilino)propanethioamide |
|---|---|
| PubChem CID | 154294390 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2R)-N-methyl-2-(4-methyl-2,6-dinitroanilino)propanethioamide |
| SMILES | CNC(=S)[C@@H](C)Nc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O4S/c1-6-4-8(14(16)17)10(9(5-6)15(18)19)13-7(2)11(20)12-3/h4-5,7,13H,1-3H3,(H,12,20)/t7-/m1/s1 |
| InChIKey | WUWPHBDXGHQSHK-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|