C12H16N4O4S — CID 57104700
2-(4-methyl-2,6-dinitroanilino)pentanethioamide (PubChem CID 57104700) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(4-methyl-2,6-dinitroanilino)pentanethioamide.
| Compound Name | 2-(4-methyl-2,6-dinitroanilino)pentanethioamide |
|---|---|
| PubChem CID | 57104700 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(4-methyl-2,6-dinitroanilino)pentanethioamide |
| SMILES | CCCC(Nc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-])C(N)=S |
| InChI | InChI=1S/C12H16N4O4S/c1-3-4-8(12(13)21)14-11-9(15(17)18)5-7(2)6-10(11)16(19)20/h5-6,8,14H,3-4H2,1-2H3,(H2,13,21) |
| InChIKey | JJKQDFVXNXNUCU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|