C11H17N3O2 — CID 54236924
2-N-butyl-5-methyl-3-nitrobenzene-1,2-diamine (PubChem CID 54236924) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-N-butyl-5-methyl-3-nitrobenzene-1,2-diamine.
| Compound Name | 2-N-butyl-5-methyl-3-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 54236924 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-N-butyl-5-methyl-3-nitrobenzene-1,2-diamine |
| SMILES | CCCCNc1c(N)cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O2/c1-3-4-5-13-11-9(12)6-8(2)7-10(11)14(15)16/h6-7,13H,3-5,12H2,1-2H3 |
| InChIKey | QNFGGJKDPYXEIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|