C10H12ClN3O4 — CID 11832572
N-butyl-3-chloro-2,6-dinitroaniline (PubChem CID 11832572) has the molecular formula C10H12ClN3O4 and a molecular weight of 273.68 g/mol. Its IUPAC name is N-butyl-3-chloro-2,6-dinitroaniline.
| Compound Name | N-butyl-3-chloro-2,6-dinitroaniline |
|---|---|
| PubChem CID | 11832572 |
| Molecular Formula | C10H12ClN3O4 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-butyl-3-chloro-2,6-dinitroaniline |
| SMILES | CCCCNc1c([N+](=O)[O-])ccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClN3O4/c1-2-3-6-12-9-8(13(15)16)5-4-7(11)10(9)14(17)18/h4-5,12H,2-3,6H2,1H3 |
| InChIKey | WQRFAWWAXSXWRE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|