C13H20N4O5 — CID 165340031
ethane;N-methyl-2-(4-methyl-2,6-dinitroanilino)propanamide (PubChem CID 165340031) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethane;N-methyl-2-(4-methyl-2,6-dinitroanilino)propanamide.
| Compound Name | ethane;N-methyl-2-(4-methyl-2,6-dinitroanilino)propanamide |
|---|---|
| PubChem CID | 165340031 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethane;N-methyl-2-(4-methyl-2,6-dinitroanilino)propanamide |
| SMILES | CC.CNC(=O)C(C)Nc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O5.C2H6/c1-6-4-8(14(17)18)10(9(5-6)15(19)20)13-7(2)11(16)12-3;1-2/h4-5,7,13H,1-3H3,(H,12,16);1-2H3 |
| InChIKey | KOSNBIAXZORKQH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|