C17H15N2O5S- — CID 7335676
2-[2-(2,4-dimethyl-6-nitroanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 7335676) has the molecular formula C17H15N2O5S- and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[2-(2,4-dimethyl-6-nitroanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-[2-(2,4-dimethyl-6-nitroanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7335676 |
| Molecular Formula | C17H15N2O5S- |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[2-(2,4-dimethyl-6-nitroanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | Cc1cc(C)c(NC(=O)CSc2ccccc2C(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-10-7-11(2)16(13(8-10)19(23)24)18-15(20)9-25-14-6-4-3-5-12(14)17(21)22/h3-8H,9H2,1-2H3,(H,18,20)(H,21,22)/p-1 |
| InChIKey | MWBTYZULVDAKEZ-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|