C17H16NO4S- — CID 4526009
2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 4526009) has the molecular formula C17H16NO4S- and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 4526009 |
| Molecular Formula | C17H16NO4S- |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CCOc1ccc(NC(=O)CSc2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H17NO4S/c1-2-22-13-9-7-12(8-10-13)18-16(19)11-23-15-6-4-3-5-14(15)17(20)21/h3-10H,2,11H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | JSCUDPMFPKCHIG-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |