C23H19N2O5- — CID 9325388
2-[[4-[(4-ethoxybenzoyl)amino]benzoyl]amino]benzoate (PubChem CID 9325388) has the molecular formula C23H19N2O5- and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-[[4-[(4-ethoxybenzoyl)amino]benzoyl]amino]benzoate.
| Compound Name | 2-[[4-[(4-ethoxybenzoyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 9325388 |
| Molecular Formula | C23H19N2O5- |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[[4-[(4-ethoxybenzoyl)amino]benzoyl]amino]benzoate |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(C(=O)Nc3ccccc3C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c1-2-30-18-13-9-16(10-14-18)21(26)24-17-11-7-15(8-12-17)22(27)25-20-6-4-3-5-19(20)23(28)29/h3-14H,2H2,1H3,(H,24,26)(H,25,27)(H,28,29)/p-1 |
| InChIKey | YWPKQFNMFLJEKF-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |