C16H11F3NO3S- — CID 4575825
2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylbenzoate (PubChem CID 4575825) has the molecular formula C16H11F3NO3S- and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylbenzoate.
| Compound Name | 2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 4575825 |
| Molecular Formula | C16H11F3NO3S- |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylbenzoate |
| SMILES | O=C(CSc1ccccc1C(=O)[O-])Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO3S/c17-16(18,19)10-5-7-11(8-6-10)20-14(21)9-24-13-4-2-1-3-12(13)15(22)23/h1-8H,9H2,(H,20,21)(H,22,23)/p-1 |
| InChIKey | LQWONBVHEQNPTB-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |