C17H13F3NO3S- — CID 6987287
2-[(1S)-2-oxo-1-phenyl-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylacetate (PubChem CID 6987287) has the molecular formula C17H13F3NO3S- and a molecular weight of 368.36 g/mol. Its IUPAC name is 2-[(1S)-2-oxo-1-phenyl-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylacetate.
| Compound Name | 2-[(1S)-2-oxo-1-phenyl-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 6987287 |
| Molecular Formula | C17H13F3NO3S- |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-[(1S)-2-oxo-1-phenyl-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylacetate |
| SMILES | O=C([O-])CS[C@H](C(=O)Nc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H14F3NO3S/c18-17(19,20)12-6-8-13(9-7-12)21-16(24)15(25-10-14(22)23)11-4-2-1-3-5-11/h1-9,15H,10H2,(H,21,24)(H,22,23)/p-1/t15-/m0/s1 |
| InChIKey | DKVAOWFZYVTMEK-HNNXBMFYSA-M |
| XLogP | 2.87 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |