C15H11ClNO3S- — CID 7301278
2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 7301278) has the molecular formula C15H11ClNO3S- and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7301278 |
| Molecular Formula | C15H11ClNO3S- |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | O=C(CSc1ccccc1C(=O)[O-])Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClNO3S/c16-10-5-7-11(8-6-10)17-14(18)9-21-13-4-2-1-3-12(13)15(19)20/h1-8H,9H2,(H,17,18)(H,19,20)/p-1 |
| InChIKey | VQQFNBRBIAVAIZ-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |