C25H29N3O6S — CID 42969968
[2-(2-methyl-6-nitroanilino)-2-oxoethyl] 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42969968) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42969968 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)COC(=O)c1ccccc1SCC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C25H29N3O6S/c1-17-8-7-12-20(28(32)33)24(17)27-22(29)15-34-25(31)19-11-5-6-13-21(19)35-16-23(30)26-14-18-9-3-2-4-10-18/h5-8,11-13,18H,2-4,9-10,14-16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | PGPVYVODMFHDQF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|