C34H45N5O6 — CID 2724328
1,1-bis[4-(3-ethylhexan-3-yl)phenyl]-2-(2,4,6-trinitrophenyl)hydrazine (PubChem CID 2724328) has the molecular formula C34H45N5O6 and a molecular weight of 619.76 g/mol. Its IUPAC name is 1,1-bis[4-(3-ethylhexan-3-yl)phenyl]-2-(2,4,6-trinitrophenyl)hydrazine.
| Compound Name | 1,1-bis[4-(3-ethylhexan-3-yl)phenyl]-2-(2,4,6-trinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 2724328 |
| Molecular Formula | C34H45N5O6 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | 1,1-bis[4-(3-ethylhexan-3-yl)phenyl]-2-(2,4,6-trinitrophenyl)hydrazine |
| SMILES | CCCC(CC)(CC)c1ccc(N(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(C(CC)(CC)CCC)cc2)cc1 |
| InChI | InChI=1S/C34H45N5O6/c1-7-21-33(9-3,10-4)25-13-17-27(18-14-25)36(28-19-15-26(16-20-28)34(11-5,12-6)22-8-2)35-32-30(38(42)43)23-29(37(40)41)24-31(32)39(44)45/h13-20,23-24,35H,7-12,21-22H2,1-6H3 |
| InChIKey | AYKRMYXOWJDIFN-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|