C14H20N2O5 — CID 174781659
1-(3-ethylhexan-3-yloxy)-2,4-dinitrobenzene (PubChem CID 174781659) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-(3-ethylhexan-3-yloxy)-2,4-dinitrobenzene.
| Compound Name | 1-(3-ethylhexan-3-yloxy)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 174781659 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-(3-ethylhexan-3-yloxy)-2,4-dinitrobenzene |
| SMILES | CCCC(CC)(CC)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O5/c1-4-9-14(5-2,6-3)21-13-8-7-11(15(17)18)10-12(13)16(19)20/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | UCTWZMZQFGHUOP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|