C16H11N4O10- — CID 23187076
2,2-bis(2,4-dinitrophenyl)butanoate (PubChem CID 23187076) has the molecular formula C16H11N4O10- and a molecular weight of 419.28 g/mol. Its IUPAC name is 2,2-bis(2,4-dinitrophenyl)butanoate.
| Compound Name | 2,2-bis(2,4-dinitrophenyl)butanoate |
|---|---|
| PubChem CID | 23187076 |
| Molecular Formula | C16H11N4O10- |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2,2-bis(2,4-dinitrophenyl)butanoate |
| SMILES | CCC(C(=O)[O-])(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N4O10/c1-2-16(15(21)22,11-5-3-9(17(23)24)7-13(11)19(27)28)12-6-4-10(18(25)26)8-14(12)20(29)30/h3-8H,2H2,1H3,(H,21,22)/p-1 |
| InChIKey | YSFBPJYJHHDZSU-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 212.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|