C11H11N3O7S — CID 20978541
2-acetamido-2-(2,4-dinitrophenyl)-3-sulfanylpropanoic acid (PubChem CID 20978541) has the molecular formula C11H11N3O7S and a molecular weight of 329.29 g/mol. Its IUPAC name is 2-acetamido-2-(2,4-dinitrophenyl)-3-sulfanylpropanoic acid.
| Compound Name | 2-acetamido-2-(2,4-dinitrophenyl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 20978541 |
| Molecular Formula | C11H11N3O7S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-acetamido-2-(2,4-dinitrophenyl)-3-sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CS)(C(=O)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O7S/c1-6(15)12-11(5-22,10(16)17)8-3-2-7(13(18)19)4-9(8)14(20)21/h2-4,22H,5H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | HYSURRRRDCCQRF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|