C21H31N3O9 — CID 53471573
2-acetamido-2-[3-[2-[[bis(2-hydroxyethyl)amino]methyl]-5-nitrophenyl]pentan-3-yl]propanedioic acid (PubChem CID 53471573) has the molecular formula C21H31N3O9 and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-acetamido-2-[3-[2-[[bis(2-hydroxyethyl)amino]methyl]-5-nitrophenyl]pentan-3-yl]propanedioic acid.
| Compound Name | 2-acetamido-2-[3-[2-[[bis(2-hydroxyethyl)amino]methyl]-5-nitrophenyl]pentan-3-yl]propanedioic acid |
|---|---|
| PubChem CID | 53471573 |
| Molecular Formula | C21H31N3O9 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-acetamido-2-[3-[2-[[bis(2-hydroxyethyl)amino]methyl]-5-nitrophenyl]pentan-3-yl]propanedioic acid |
| SMILES | CCC(CC)(c1cc([N+](=O)[O-])ccc1CN(CCO)CCO)C(NC(C)=O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H31N3O9/c1-4-20(5-2,21(18(28)29,19(30)31)22-14(3)27)17-12-16(24(32)33)7-6-15(17)13-23(8-10-25)9-11-26/h6-7,12,25-26H,4-5,8-11,13H2,1-3H3,(H,22,27)(H,28,29)(H,30,31) |
| InChIKey | VIZUSIUXLCIEDS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 190.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|