C20H20N4O12 — CID 158895559
2,2-bis(2,4-dinitrophenyl)butanoic acid;ethyl acetate (PubChem CID 158895559) has the molecular formula C20H20N4O12 and a molecular weight of 508.40 g/mol. Its IUPAC name is 2,2-bis(2,4-dinitrophenyl)butanoic acid;ethyl acetate.
| Compound Name | 2,2-bis(2,4-dinitrophenyl)butanoic acid;ethyl acetate |
|---|---|
| PubChem CID | 158895559 |
| Molecular Formula | C20H20N4O12 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2,2-bis(2,4-dinitrophenyl)butanoic acid;ethyl acetate |
| SMILES | CCC(C(=O)O)(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].CCOC(C)=O |
| InChI | InChI=1S/C16H12N4O10.C4H8O2/c1-2-16(15(21)22,11-5-3-9(17(23)24)7-13(11)19(27)28)12-6-4-10(18(25)26)8-14(12)20(29)30;1-3-6-4(2)5/h3-8H,2H2,1H3,(H,21,22);3H2,1-2H3 |
| InChIKey | JEUBYJMGOFUQBK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 236.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|