C12H12N4O7 — CID 10925368
ethyl (E)-4-[2-(2,4-dinitrophenyl)hydrazinyl]-4-oxobut-2-enoate (PubChem CID 10925368) has the molecular formula C12H12N4O7 and a molecular weight of 324.25 g/mol. Its IUPAC name is ethyl (E)-4-[2-(2,4-dinitrophenyl)hydrazinyl]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[2-(2,4-dinitrophenyl)hydrazinyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 10925368 |
| Molecular Formula | C12H12N4O7 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | ethyl (E)-4-[2-(2,4-dinitrophenyl)hydrazinyl]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O7/c1-2-23-12(18)6-5-11(17)14-13-9-4-3-8(15(19)20)7-10(9)16(21)22/h3-7,13H,2H2,1H3,(H,14,17)/b6-5+ |
| InChIKey | AFPNNCMBSMDTFY-AATRIKPKSA-N |
| XLogP | 1.07 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|