C11H11ClN4O6 — CID 129382287
ethyl (2R,3Z)-2-chloro-3-[(2,4-dinitrophenyl)hydrazinylidene]propanoate (PubChem CID 129382287) has the molecular formula C11H11ClN4O6 and a molecular weight of 330.68 g/mol. Its IUPAC name is ethyl (2R,3Z)-2-chloro-3-[(2,4-dinitrophenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl (2R,3Z)-2-chloro-3-[(2,4-dinitrophenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 129382287 |
| Molecular Formula | C11H11ClN4O6 |
| Molecular Weight | 330.68 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | ethyl (2R,3Z)-2-chloro-3-[(2,4-dinitrophenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)[C@H](Cl)/C=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN4O6/c1-2-22-11(17)8(12)6-13-14-9-4-3-7(15(18)19)5-10(9)16(20)21/h3-6,8,14H,2H2,1H3/b13-6-/t8-/m1/s1 |
| InChIKey | NPHBISZQFZNPEL-NWKJQJTJSA-N |
| XLogP | 2.07 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|