C12H15N3O6 — CID 19786233
2-amino-2-(2,4-dinitrophenyl)hexanoic acid (PubChem CID 19786233) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-amino-2-(2,4-dinitrophenyl)hexanoic acid.
| Compound Name | 2-amino-2-(2,4-dinitrophenyl)hexanoic acid |
|---|---|
| PubChem CID | 19786233 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-amino-2-(2,4-dinitrophenyl)hexanoic acid |
| SMILES | CCCCC(N)(C(=O)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O6/c1-2-3-6-12(13,11(16)17)9-5-4-8(14(18)19)7-10(9)15(20)21/h4-5,7H,2-3,6,13H2,1H3,(H,16,17) |
| InChIKey | QSOHFRLCPGIOGA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|