C16H20N4O9 — CID 86747325
2-amino-2-(2,4-dinitrophenyl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 86747325) has the molecular formula C16H20N4O9 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-amino-2-(2,4-dinitrophenyl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 2-amino-2-(2,4-dinitrophenyl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86747325 |
| Molecular Formula | C16H20N4O9 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-amino-2-(2,4-dinitrophenyl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | CCCCC(N)(C(=O)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C1CCC(=O)N1O |
| InChI | InChI=1S/C12H15N3O6.C4H5NO3/c1-2-3-6-12(13,11(16)17)9-5-4-8(14(18)19)7-10(9)15(20)21;6-3-1-2-4(7)5(3)8/h4-5,7H,2-3,6,13H2,1H3,(H,16,17);8H,1-2H2 |
| InChIKey | HAVDNDSXGDTNDJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|