C18H16N4O13 — CID 142722325
2-(2-hydroxyethoxy)ethyl 2,2-bis(2,4-dinitrophenyl)-2-hydroxyacetate (PubChem CID 142722325) has the molecular formula C18H16N4O13 and a molecular weight of 496.34 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2,2-bis(2,4-dinitrophenyl)-2-hydroxyacetate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2,2-bis(2,4-dinitrophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 142722325 |
| Molecular Formula | C18H16N4O13 |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2,2-bis(2,4-dinitrophenyl)-2-hydroxyacetate |
| SMILES | O=C(OCCOCCO)C(O)(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N4O13/c23-5-6-34-7-8-35-17(24)18(25,13-3-1-11(19(26)27)9-15(13)21(30)31)14-4-2-12(20(28)29)10-16(14)22(32)33/h1-4,9-10,23,25H,5-8H2 |
| InChIKey | WNEBHZMCQXEFGI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 248.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|