C22H24N2O11 — CID 86743028
2-hydroxy-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]-1,3-bis(3-nitrophenyl)propane-1,3-dione (PubChem CID 86743028) has the molecular formula C22H24N2O11 and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-hydroxy-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]-1,3-bis(3-nitrophenyl)propane-1,3-dione.
| Compound Name | 2-hydroxy-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]-1,3-bis(3-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 86743028 |
| Molecular Formula | C22H24N2O11 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-hydroxy-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]-1,3-bis(3-nitrophenyl)propane-1,3-dione |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)C(O)(COCCOCCOCCO)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N2O11/c25-7-8-33-9-10-34-11-12-35-15-22(28,20(26)16-3-1-5-18(13-16)23(29)30)21(27)17-4-2-6-19(14-17)24(31)32/h1-6,13-14,25,28H,7-12,15H2 |
| InChIKey | PSMMZFSVXRILCL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|