C12H17N3O9P- — CID 22267098
amino-[1-(2,4-dinitrophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinite (PubChem CID 22267098) has the molecular formula C12H17N3O9P- and a molecular weight of 378.25 g/mol. Its IUPAC name is amino-[1-(2,4-dinitrophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinite.
| Compound Name | amino-[1-(2,4-dinitrophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinite |
|---|---|
| PubChem CID | 22267098 |
| Molecular Formula | C12H17N3O9P- |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | amino-[1-(2,4-dinitrophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinite |
| SMILES | NP([O-])OC(COCCOCCO)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O9P/c13-25(21)24-12(8-23-6-5-22-4-3-16)10-2-1-9(14(17)18)7-11(10)15(19)20/h1-2,7,12,16H,3-6,8,13H2/q-1 |
| InChIKey | XHRQNHRRCNPXRF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 183.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|