C24H14N8O12 — CID 172790717
1,1-diphenyl-2,2-bis(2,4,6-trinitrophenyl)hydrazine (PubChem CID 172790717) has the molecular formula C24H14N8O12 and a molecular weight of 606.42 g/mol. Its IUPAC name is 1,1-diphenyl-2,2-bis(2,4,6-trinitrophenyl)hydrazine.
| Compound Name | 1,1-diphenyl-2,2-bis(2,4,6-trinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 172790717 |
| Molecular Formula | C24H14N8O12 |
| Molecular Weight | 606.42 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | 1,1-diphenyl-2,2-bis(2,4,6-trinitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N(c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])N(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H14N8O12/c33-27(34)17-11-19(29(37)38)23(20(12-17)30(39)40)26(25(15-7-3-1-4-8-15)16-9-5-2-6-10-16)24-21(31(41)42)13-18(28(35)36)14-22(24)32(43)44/h1-14H |
| InChIKey | PNLWPJAXPHWSNG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 265.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|