C21H13NO4 — CID 19084347
8-nitrospiro[chromene-2,9'-xanthene] (PubChem CID 19084347) has the molecular formula C21H13NO4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 8-nitrospiro[chromene-2,9'-xanthene].
| Compound Name | 8-nitrospiro[chromene-2,9'-xanthene] |
|---|---|
| PubChem CID | 19084347 |
| Molecular Formula | C21H13NO4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 8-nitrospiro[chromene-2,9'-xanthene] |
| SMILES | O=[N+]([O-])c1cccc2c1OC1(C=C2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H13NO4/c23-22(24)17-9-5-6-14-12-13-21(26-20(14)17)15-7-1-3-10-18(15)25-19-11-4-2-8-16(19)21/h1-13H |
| InChIKey | LLBXFQFHCJCUEH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|