C62H40BBrN2O8 — CID 157178367
1-bromospiro[fluorene-9,9'-xanthene];(2-nitrophenyl)boronic acid;1-(2-nitrophenyl)spiro[fluorene-9,9'-xanthene] (PubChem CID 157178367) has the molecular formula C62H40BBrN2O8 and a molecular weight of 1031.72 g/mol. Its IUPAC name is 1-bromospiro[fluorene-9,9'-xanthene];(2-nitrophenyl)boronic acid;1-(2-nitrophenyl)spiro[fluorene-9,9'-xanthene].
| Compound Name | 1-bromospiro[fluorene-9,9'-xanthene];(2-nitrophenyl)boronic acid;1-(2-nitrophenyl)spiro[fluorene-9,9'-xanthene] |
|---|---|
| PubChem CID | 157178367 |
| Molecular Formula | C62H40BBrN2O8 |
| Molecular Weight | 1031.72 g/mol |
| Exact Mass | 1030.21 |
| IUPAC Name | 1-bromospiro[fluorene-9,9'-xanthene];(2-nitrophenyl)boronic acid;1-(2-nitrophenyl)spiro[fluorene-9,9'-xanthene] |
| SMILES | Brc1cccc2c1C1(c3ccccc3Oc3ccccc31)c1ccccc1-2.O=[N+]([O-])c1ccccc1-c1cccc2c1C1(c3ccccc3Oc3ccccc31)c1ccccc1-2.O=[N+]([O-])c1ccccc1B(O)O |
| InChI | InChI=1S/C31H19NO3.C25H15BrO.C6H6BNO4/c33-32(34)27-17-6-2-11-21(27)23-13-9-12-22-20-10-1-3-14-24(20)31(30(22)23)25-15-4-7-18-28(25)35-29-19-8-5-16-26(29)31;26-21-13-7-9-17-16-8-1-2-10-18(16)25(24(17)21)19-11-3-5-14-22(19)27-23-15-6-4-12-20(23)25;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-19H;1-15H;1-4,9-10H |
| InChIKey | AOHATYQXTAHKJU-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.72 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|