C39H24BrNO2 — CID 169023430
1-bromo-9,9-dinaphthalen-1-yl-6-(2-nitrophenyl)fluorene (PubChem CID 169023430) has the molecular formula C39H24BrNO2 and a molecular weight of 618.53 g/mol. Its IUPAC name is 1-bromo-9,9-dinaphthalen-1-yl-6-(2-nitrophenyl)fluorene.
| Compound Name | 1-bromo-9,9-dinaphthalen-1-yl-6-(2-nitrophenyl)fluorene |
|---|---|
| PubChem CID | 169023430 |
| Molecular Formula | C39H24BrNO2 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 1-bromo-9,9-dinaphthalen-1-yl-6-(2-nitrophenyl)fluorene |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc2c(c1)-c1cccc(Br)c1C2(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C39H24BrNO2/c40-36-20-9-17-31-32-24-27(30-16-5-6-21-37(30)41(42)43)22-23-35(32)39(38(31)36,33-18-7-12-25-10-1-3-14-28(25)33)34-19-8-13-26-11-2-4-15-29(26)34/h1-24H |
| InChIKey | GGIXXTFYUQJTBZ-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|