About (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene
(2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene (PubChem CID 159481445) has the molecular formula C24H18BBr2IN2O6
and a molecular weight of 727.94 g/mol. Its IUPAC name is (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene.
Molecular Properties
| Compound Name | (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene |
| PubChem CID | 159481445 |
| Molecular Formula | C24H18BBr2IN2O6 |
| Molecular Weight | 727.94 g/mol |
| Exact Mass | 725.87 |
| IUPAC Name | (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccccc1Br.O=[N+]([O-])c1ccccc1I.OB(O)c1ccccc1Br |
| InChI | InChI=1S/C12H8BrNO2.C6H6BBrO2.C6H4INO2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(15)16;8-6-4-2-1-3-5(6)7(9)10;7-5-3-1-2-4-6(5)8(9)10/h1-8H;1-4,9-10H;1-4H |
| InChIKey | LXBACRALHVKEKU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 727.94 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene?
The IUPAC name of (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene (CID 159481445) is (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene.
What is the SMILES notation for (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene?
The canonical SMILES for (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene is O=[N+]([O-])c1ccccc1-c1ccccc1Br.O=[N+]([O-])c1ccccc1I.OB(O)c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene?
The InChIKey is LXBACRALHVKEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO2.C6H6BBrO2.C6H4INO2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(15)16;8-6-4-2-1-3-5(6)7(9)10;7-5-3-1-2-4-6(5)8(9)10/h1-8H;1-4,9-10H;1-4H.
What are the key properties of (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene?
(2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene has a molecular weight of 727.94 g/mol, XLogP of 6.35, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)boronic acid;1-(2-bromophenyl)-2-nitrobenzene;1-iodo-2-nitrobenzene is sourced from PubChem (CID 159481445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).