About 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene
1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene (PubChem CID 159158265) has the molecular formula C28H20BBrN2O6S2
and a molecular weight of 635.33 g/mol. Its IUPAC name is 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene.
Molecular Properties
| Compound Name | 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene |
| PubChem CID | 159158265 |
| Molecular Formula | C28H20BBrN2O6S2 |
| Molecular Weight | 635.33 g/mol |
| Exact Mass | 634.00 |
| IUPAC Name | 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2ccccc2s1.O=[N+]([O-])c1ccccc1Br.OB(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H9NO2S.C8H7BO2S.C6H4BrNO2/c16-15(17)12-7-3-2-6-11(12)14-9-10-5-1-4-8-13(10)18-14;10-9(11)8-5-6-3-1-2-4-7(6)12-8;7-5-3-1-2-4-6(5)8(9)10/h1-9H;1-5,10-11H;1-4H |
| InChIKey | KKDYZSVUNNOJSB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 635.33 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene?
The IUPAC name of 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene (CID 159158265) is 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene.
What is the SMILES notation for 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene?
The canonical SMILES for 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene is O=[N+]([O-])c1ccccc1-c1cc2ccccc2s1.O=[N+]([O-])c1ccccc1Br.OB(O)c1cc2ccccc2s1.
What is the InChIKey of 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene?
The InChIKey is KKDYZSVUNNOJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2S.C8H7BO2S.C6H4BrNO2/c16-15(17)12-7-3-2-6-11(12)14-9-10-5-1-4-8-13(10)18-14;10-9(11)8-5-6-3-1-2-4-7(6)12-8;7-5-3-1-2-4-6(5)8(9)10/h1-9H;1-5,10-11H;1-4H.
What are the key properties of 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene?
1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene has a molecular weight of 635.33 g/mol, XLogP of 7.41, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-2-ylboronic acid;1-bromo-2-nitrobenzene;2-(2-nitrophenyl)-1-benzothiophene is sourced from PubChem (CID 159158265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).