C13H17NO4 — CID 141395418
2-butyl-2-ethyl-4-nitro-1,3-benzodioxole (PubChem CID 141395418) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-butyl-2-ethyl-4-nitro-1,3-benzodioxole.
| Compound Name | 2-butyl-2-ethyl-4-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 141395418 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-butyl-2-ethyl-4-nitro-1,3-benzodioxole |
| SMILES | CCCCC1(CC)Oc2cccc([N+](=O)[O-])c2O1 |
| InChI | InChI=1S/C13H17NO4/c1-3-5-9-13(4-2)17-11-8-6-7-10(14(15)16)12(11)18-13/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | XSMBOGZNBKCRAR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|