C10H10BrNO3 — CID 22404724
3-bromo-2,2-dimethyl-7-nitro-3H-1-benzofuran (PubChem CID 22404724) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is 3-bromo-2,2-dimethyl-7-nitro-3H-1-benzofuran.
| Compound Name | 3-bromo-2,2-dimethyl-7-nitro-3H-1-benzofuran |
|---|---|
| PubChem CID | 22404724 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 3-bromo-2,2-dimethyl-7-nitro-3H-1-benzofuran |
| SMILES | CC1(C)Oc2c(cccc2[N+](=O)[O-])C1Br |
| InChI | InChI=1S/C10H10BrNO3/c1-10(2)9(11)6-4-3-5-7(12(13)14)8(6)15-10/h3-5,9H,1-2H3 |
| InChIKey | ZQFQGTUWROOKBW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|